About 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione
6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione (PubChem CID 89156071) has the molecular formula C9H7BrFNS
and a molecular weight of 260.13 g/mol. Its IUPAC name is 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione.
Molecular Properties
| Compound Name | 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione |
| PubChem CID | 89156071 |
| Molecular Formula | C9H7BrFNS |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione |
| SMILES | Fc1cc(Br)cc2c1NC(=S)CC2 |
| InChI | InChI=1S/C9H7BrFNS/c10-6-3-5-1-2-8(13)12-9(5)7(11)4-6/h3-4H,1-2H2,(H,12,13) |
| InChIKey | URRIZHCIWULPDU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione?
The IUPAC name of 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione (CID 89156071) is 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione.
What is the SMILES notation for 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione?
The canonical SMILES for 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione is Fc1cc(Br)cc2c1NC(=S)CC2.
What is the InChIKey of 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione?
The InChIKey is URRIZHCIWULPDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrFNS/c10-6-3-5-1-2-8(13)12-9(5)7(11)4-6/h3-4H,1-2H2,(H,12,13).
What are the key properties of 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione?
6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione has a molecular weight of 260.13 g/mol, XLogP of 3.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-fluoro-3,4-dihydro-1H-quinoline-2-thione is sourced from PubChem (CID 89156071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).