C9H5F5O4S — CID 89156448
(2,3,4,5,6-pentafluorophenyl) 2-methylsulfonylacetate (PubChem CID 89156448) has the molecular formula C9H5F5O4S and a molecular weight of 304.19 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-methylsulfonylacetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-methylsulfonylacetate |
|---|---|
| PubChem CID | 89156448 |
| Molecular Formula | C9H5F5O4S |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-methylsulfonylacetate |
| SMILES | CS(=O)(=O)CC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H5F5O4S/c1-19(16,17)2-3(15)18-9-7(13)5(11)4(10)6(12)8(9)14/h2H2,1H3 |
| InChIKey | DMLZAFZDOJWVNR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|