C23H17Cl2FN4OS — CID 89156615
4-amino-5-(2-chlorophenyl)-2-[[(2S,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 89156615) has the molecular formula C23H17Cl2FN4OS and a molecular weight of 487.39 g/mol. Its IUPAC name is 4-amino-5-(2-chlorophenyl)-2-[[(2S,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-amino-5-(2-chlorophenyl)-2-[[(2S,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 89156615 |
| Molecular Formula | C23H17Cl2FN4OS |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 4-amino-5-(2-chlorophenyl)-2-[[(2S,3S)-3-(2-chlorophenyl)-2-(4-fluorophenyl)oxiran-2-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | Nn1c(-c2ccccc2Cl)nn(C[C@]2(c3ccc(F)cc3)O[C@H]2c2ccccc2Cl)c1=S |
| InChI | InChI=1S/C23H17Cl2FN4OS/c24-18-7-3-1-5-16(18)20-23(31-20,14-9-11-15(26)12-10-14)13-29-22(32)30(27)21(28-29)17-6-2-4-8-19(17)25/h1-12,20H,13,27H2/t20-,23+/m0/s1 |
| InChIKey | OSNOCGKUKPYCLR-NZQKXSOJSA-N |
| XLogP | 5.91 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|