About (4Z,6Z)-3-ethylocta-4,6-dien-1-amine
(4Z,6Z)-3-ethylocta-4,6-dien-1-amine (PubChem CID 89156620) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is (4Z,6Z)-3-ethylocta-4,6-dien-1-amine.
Molecular Properties
| Compound Name | (4Z,6Z)-3-ethylocta-4,6-dien-1-amine |
| PubChem CID | 89156620 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (4Z,6Z)-3-ethylocta-4,6-dien-1-amine |
| SMILES | C/C=C\C=C/C(CC)CCN |
| InChI | InChI=1S/C10H19N/c1-3-5-6-7-10(4-2)8-9-11/h3,5-7,10H,4,8-9,11H2,1-2H3/b5-3-,7-6- |
| InChIKey | PQDWFCQWWJEXMJ-VKLRWAGZSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z,6Z)-3-ethylocta-4,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6Z)-3-ethylocta-4,6-dien-1-amine?
The IUPAC name of (4Z,6Z)-3-ethylocta-4,6-dien-1-amine (CID 89156620) is (4Z,6Z)-3-ethylocta-4,6-dien-1-amine.
What is the SMILES notation for (4Z,6Z)-3-ethylocta-4,6-dien-1-amine?
The canonical SMILES for (4Z,6Z)-3-ethylocta-4,6-dien-1-amine is C/C=C\C=C/C(CC)CCN.
What is the InChIKey of (4Z,6Z)-3-ethylocta-4,6-dien-1-amine?
The InChIKey is PQDWFCQWWJEXMJ-VKLRWAGZSA-N. The full InChI is InChI=1S/C10H19N/c1-3-5-6-7-10(4-2)8-9-11/h3,5-7,10H,4,8-9,11H2,1-2H3/b5-3-,7-6-.
What are the key properties of (4Z,6Z)-3-ethylocta-4,6-dien-1-amine?
(4Z,6Z)-3-ethylocta-4,6-dien-1-amine has a molecular weight of 153.27 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6Z)-3-ethylocta-4,6-dien-1-amine is sourced from PubChem (CID 89156620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).