About tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride
tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride (PubChem CID 89157041) has the molecular formula C10H20ClF3N2O4
and a molecular weight of 324.73 g/mol. Its IUPAC name is tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride |
| PubChem CID | 89157041 |
| Molecular Formula | C10H20ClF3N2O4 |
| Molecular Weight | 324.73 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride |
| SMILES | CN(CCN)C(=O)OC(C)(C)C.Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C8H18N2O2.C2HF3O2.ClH/c1-8(2,3)12-7(11)10(4)6-5-9;3-2(4,5)1(6)7;/h5-6,9H2,1-4H3;(H,6,7);1H |
| InChIKey | ZRPQFEKSIIONSW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride?
The IUPAC name of tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride (CID 89157041) is tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride.
What is the SMILES notation for tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride?
The canonical SMILES for tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride is CN(CCN)C(=O)OC(C)(C)C.Cl.O=C(O)C(F)(F)F.
What is the InChIKey of tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride?
The InChIKey is ZRPQFEKSIIONSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2.C2HF3O2.ClH/c1-8(2,3)12-7(11)10(4)6-5-9;3-2(4,5)1(6)7;/h5-6,9H2,1-4H3;(H,6,7);1H.
What are the key properties of tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride?
tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride has a molecular weight of 324.73 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2-aminoethyl)-N-methylcarbamate;2,2,2-trifluoroacetic acid;hydrochloride is sourced from PubChem (CID 89157041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).