C14H17F3N3O5+ — CID 89157282
[2,5-dioxo-1-(4-oxo-4-piperazin-1-ylbutyl)pyrrol-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 89157282) has the molecular formula C14H17F3N3O5+ and a molecular weight of 364.30 g/mol. Its IUPAC name is [2,5-dioxo-1-(4-oxo-4-piperazin-1-ylbutyl)pyrrol-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2,5-dioxo-1-(4-oxo-4-piperazin-1-ylbutyl)pyrrol-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89157282 |
| Molecular Formula | C14H17F3N3O5+ |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2,5-dioxo-1-(4-oxo-4-piperazin-1-ylbutyl)pyrrol-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(CCC[N+]1(OC(=O)C(F)(F)F)C(=O)C=CC1=O)N1CCNCC1 |
| InChI | InChI=1S/C14H17F3N3O5/c15-14(16,17)13(24)25-20(11(22)3-4-12(20)23)9-1-2-10(21)19-7-5-18-6-8-19/h3-4,18H,1-2,5-9H2/q+1 |
| InChIKey | YIYQCEGJHKASQW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|