C25H26N6O2 — CID 89157461
4-[2-(4-amino-2-ethoxyanilino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-N-(cyclopropylmethyl)benzamide (PubChem CID 89157461) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[2-(4-amino-2-ethoxyanilino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-N-(cyclopropylmethyl)benzamide.
| Compound Name | 4-[2-(4-amino-2-ethoxyanilino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-N-(cyclopropylmethyl)benzamide |
|---|---|
| PubChem CID | 89157461 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 4-[2-(4-amino-2-ethoxyanilino)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]-N-(cyclopropylmethyl)benzamide |
| SMILES | CCOc1cc(N)ccc1Nc1nc2ccc(-c3ccc(C(=O)NCC4CC4)cc3)cn2n1 |
| InChI | InChI=1S/C25H26N6O2/c1-2-33-22-13-20(26)10-11-21(22)28-25-29-23-12-9-19(15-31(23)30-25)17-5-7-18(8-6-17)24(32)27-14-16-3-4-16/h5-13,15-16H,2-4,14,26H2,1H3,(H,27,32)(H,28,30) |
| InChIKey | ZCDRZGYLBFGYFP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|