amino N-ethyl-N-methylcarbamate

C4H10N2O2 — CID 89157938

IUPACamino N-ethyl-N-methylcarbamate
SMILESCCN(C)C(=O)ON
InChIInChI=1S/C4H10N2O2/c1-3-6(2)4(7)8-5/h3,5H2,1-2H3
InChIKeyDGLISUUWGPZWFF-UHFFFAOYSA-N
MW118.14 g/mol
LogP-0.05
Rot. Bonds1

About amino N-ethyl-N-methylcarbamate

amino N-ethyl-N-methylcarbamate (PubChem CID 89157938) has the molecular formula C4H10N2O2 and a molecular weight of 118.14 g/mol. Its IUPAC name is amino N-ethyl-N-methylcarbamate.

Molecular Properties

Compound Nameamino N-ethyl-N-methylcarbamate
PubChem CID89157938
Molecular FormulaC4H10N2O2
Molecular Weight118.14 g/mol
Exact Mass118.07
IUPAC Nameamino N-ethyl-N-methylcarbamate
SMILESCCN(C)C(=O)ON
InChIInChI=1S/C4H10N2O2/c1-3-6(2)4(7)8-5/h3,5H2,1-2H3
InChIKeyDGLISUUWGPZWFF-UHFFFAOYSA-N
XLogP-0.05
TPSA55.56 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500118.14
LogP ≤ 5-0.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino N-ethyl-N-methylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino N-ethyl-N-methylcarbamate?
The IUPAC name of amino N-ethyl-N-methylcarbamate (CID 89157938) is amino N-ethyl-N-methylcarbamate.
What is the SMILES notation for amino N-ethyl-N-methylcarbamate?
The canonical SMILES for amino N-ethyl-N-methylcarbamate is CCN(C)C(=O)ON.
What is the InChIKey of amino N-ethyl-N-methylcarbamate?
The InChIKey is DGLISUUWGPZWFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c1-3-6(2)4(7)8-5/h3,5H2,1-2H3.
What are the key properties of amino N-ethyl-N-methylcarbamate?
amino N-ethyl-N-methylcarbamate has a molecular weight of 118.14 g/mol, XLogP of -0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino N-ethyl-N-methylcarbamate is sourced from PubChem (CID 89157938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).