About 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid
2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid (PubChem CID 89158089) has the molecular formula C7H7Cl2N2O4+
and a molecular weight of 254.05 g/mol. Its IUPAC name is 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid |
| PubChem CID | 89158089 |
| Molecular Formula | C7H7Cl2N2O4+ |
| Molecular Weight | 254.05 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid |
| SMILES | O=C(O)Cn1c[n+](CC(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C7H6Cl2N2O4/c8-6-7(9)11(2-5(14)15)3-10(6)1-4(12)13/h3H,1-2H2,(H-,12,13,14,15)/p+1 |
| InChIKey | FPMYQBIXKPNHRQ-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 83.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.05 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid?
The IUPAC name of 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid (CID 89158089) is 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid.
What is the SMILES notation for 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid?
The canonical SMILES for 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid is O=C(O)Cn1c[n+](CC(=O)O)c(Cl)c1Cl.
What is the InChIKey of 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid?
The InChIKey is FPMYQBIXKPNHRQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H6Cl2N2O4/c8-6-7(9)11(2-5(14)15)3-10(6)1-4(12)13/h3H,1-2H2,(H-,12,13,14,15)/p+1.
What are the key properties of 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid?
2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid has a molecular weight of 254.05 g/mol, XLogP of 0.25, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(carboxymethyl)-4,5-dichloroimidazol-3-ium-1-yl]acetic acid is sourced from PubChem (CID 89158089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).