About 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine
4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine (PubChem CID 891582) has the molecular formula C20H17N5
and a molecular weight of 327.39 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 891582 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine |
| SMILES | Cc1cccc(-n2ncc3c(N4CCc5ccccc54)ncnc32)c1 |
| InChI | InChI=1S/C20H17N5/c1-14-5-4-7-16(11-14)25-20-17(12-23-25)19(21-13-22-20)24-10-9-15-6-2-3-8-18(15)24/h2-8,11-13H,9-10H2,1H3 |
| InChIKey | JDPDFXLPCVOESS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine (CID 891582) is 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine is Cc1cccc(-n2ncc3c(N4CCc5ccccc54)ncnc32)c1.
What is the InChIKey of 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine?
The InChIKey is JDPDFXLPCVOESS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N5/c1-14-5-4-7-16(11-14)25-20-17(12-23-25)19(21-13-22-20)24-10-9-15-6-2-3-8-18(15)24/h2-8,11-13H,9-10H2,1H3.
What are the key properties of 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine?
4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine has a molecular weight of 327.39 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydroindol-1-yl)-1-(3-methylphenyl)pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 891582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).