C30H33F3N7O7P — CID 89158514
[6-azidohexoxycarbonyl-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]amino] 2,2,2-trifluoroacetate (PubChem CID 89158514) has the molecular formula C30H33F3N7O7P and a molecular weight of 691.60 g/mol. Its IUPAC name is [6-azidohexoxycarbonyl-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [6-azidohexoxycarbonyl-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89158514 |
| Molecular Formula | C30H33F3N7O7P |
| Molecular Weight | 691.60 g/mol |
| Exact Mass | 691.21 |
| IUPAC Name | [6-azidohexoxycarbonyl-[2-[4-(diaminomethylideneamino)phenyl]-1-diphenoxyphosphorylethyl]amino] 2,2,2-trifluoroacetate |
| SMILES | [N-]=[N+]=NCCCCCCOC(=O)N(OC(=O)C(F)(F)F)C(Cc1ccc(N=C(N)N)cc1)P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C30H33F3N7O7P/c31-30(32,33)27(41)45-40(29(42)44-20-10-2-1-9-19-37-39-36)26(21-22-15-17-23(18-16-22)38-28(34)35)48(43,46-24-11-5-3-6-12-24)47-25-13-7-4-8-14-25/h3-8,11-18,26H,1-2,9-10,19-21H2,(H4,34,35,38) |
| InChIKey | TTXYLKDUNRCSKW-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 204.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.60 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|