About N-(diethylamino)nitrous amide
N-(diethylamino)nitrous amide (PubChem CID 89158951) has the molecular formula C4H11N3O
and a molecular weight of 117.15 g/mol. Its IUPAC name is N-(diethylamino)nitrous amide.
Molecular Properties
| Compound Name | N-(diethylamino)nitrous amide |
| PubChem CID | 89158951 |
| Molecular Formula | C4H11N3O |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.09 |
| IUPAC Name | N-(diethylamino)nitrous amide |
| SMILES | CCN(CC)NN=O |
| InChI | InChI=1S/C4H11N3O/c1-3-7(4-2)5-6-8/h3-4H2,1-2H3,(H,5,8) |
| InChIKey | PZDKNSMEXPRJRK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(diethylamino)nitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diethylamino)nitrous amide?
The IUPAC name of N-(diethylamino)nitrous amide (CID 89158951) is N-(diethylamino)nitrous amide.
What is the SMILES notation for N-(diethylamino)nitrous amide?
The canonical SMILES for N-(diethylamino)nitrous amide is CCN(CC)NN=O.
What is the InChIKey of N-(diethylamino)nitrous amide?
The InChIKey is PZDKNSMEXPRJRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3O/c1-3-7(4-2)5-6-8/h3-4H2,1-2H3,(H,5,8).
What are the key properties of N-(diethylamino)nitrous amide?
N-(diethylamino)nitrous amide has a molecular weight of 117.15 g/mol, XLogP of 0.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diethylamino)nitrous amide is sourced from PubChem (CID 89158951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).