C10H12F6 — CID 89159384
2,5-bis(trifluoromethyl)-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 89159384) has the molecular formula C10H12F6 and a molecular weight of 246.19 g/mol. Its IUPAC name is 2,5-bis(trifluoromethyl)-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 2,5-bis(trifluoromethyl)-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 89159384 |
| Molecular Formula | C10H12F6 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2,5-bis(trifluoromethyl)-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | FC(F)(F)C1CC2CC(C(F)(F)F)CC2C1 |
| InChI | InChI=1S/C10H12F6/c11-9(12,13)7-1-5-2-8(10(14,15)16)4-6(5)3-7/h5-8H,1-4H2 |
| InChIKey | UTEPWWYGUJGPDB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |