C11H14N4 — CID 89159479
N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methyl-1,3,5-triazin-2-amine (PubChem CID 89159479) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methyl-1,3,5-triazin-2-amine.
| Compound Name | N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 89159479 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4-methyl-1,3,5-triazin-2-amine |
| SMILES | C=C/C=C\C(=C/C)Nc1ncnc(C)n1 |
| InChI | InChI=1S/C11H14N4/c1-4-6-7-10(5-2)15-11-13-8-12-9(3)14-11/h4-8H,1H2,2-3H3,(H,12,13,14,15)/b7-6-,10-5+ |
| InChIKey | LCCOAGOWWZPUSX-JQEGGOPCSA-N |
| XLogP | 2.24 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|