C13H24N2OS — CID 89159480
2-amino-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-methylsulfanylacetamide (PubChem CID 89159480) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is 2-amino-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-methylsulfanylacetamide.
| Compound Name | 2-amino-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 89159480 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-amino-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-methylsulfanylacetamide |
| SMILES | CSC(N)C(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H24N2OS/c1-10(2)6-5-7-11(3)8-9-15-13(16)12(14)17-4/h6,8,12H,5,7,9,14H2,1-4H3,(H,15,16)/b11-8+ |
| InChIKey | MYRXLPOJOFUBSS-DHZHZOJOSA-N |
| XLogP | 2.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|