C20H23F11O2 — CID 89159780
[5-methyl-1-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)hexan-3-yl] 1-(trifluoromethyl)cyclohex-3-ene-1-carboxylate (PubChem CID 89159780) has the molecular formula C20H23F11O2 and a molecular weight of 504.38 g/mol. Its IUPAC name is [5-methyl-1-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)hexan-3-yl] 1-(trifluoromethyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | [5-methyl-1-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)hexan-3-yl] 1-(trifluoromethyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 89159780 |
| Molecular Formula | C20H23F11O2 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | [5-methyl-1-(1,2,2,3,3,4,4,5-octafluorocyclopentyl)hexan-3-yl] 1-(trifluoromethyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CC(C)CC(CCC1(F)C(F)C(F)(F)C(F)(F)C1(F)F)OC(=O)C1(C(F)(F)F)CC=CCC1 |
| InChI | InChI=1S/C20H23F11O2/c1-11(2)10-12(33-14(32)15(20(29,30)31)7-4-3-5-8-15)6-9-16(22)13(21)17(23,24)19(27,28)18(16,25)26/h3-4,11-13H,5-10H2,1-2H3 |
| InChIKey | BAVUXMUVZGJTHO-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|