C15H22F6O — CID 89159921
2-[[3-[(Z)-but-2-enyl]-4-methylcyclohexyl]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 89159921) has the molecular formula C15H22F6O and a molecular weight of 332.33 g/mol. Its IUPAC name is 2-[[3-[(Z)-but-2-enyl]-4-methylcyclohexyl]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[[3-[(Z)-but-2-enyl]-4-methylcyclohexyl]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 89159921 |
| Molecular Formula | C15H22F6O |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[[3-[(Z)-but-2-enyl]-4-methylcyclohexyl]methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C/C=C\CC1CC(CC(O)(C(F)(F)F)C(F)(F)F)CCC1C |
| InChI | InChI=1S/C15H22F6O/c1-3-4-5-12-8-11(7-6-10(12)2)9-13(22,14(16,17)18)15(19,20)21/h3-4,10-12,22H,5-9H2,1-2H3/b4-3- |
| InChIKey | BXALMBQQIJMSNC-ARJAWSKDSA-N |
| XLogP | 5.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|