C19H25ClFN7 — CID 89160299
2-[(1S,2Z,4E)-2-amino-1-cyclopropyl-5-fluorohepta-2,4,6-trienyl]-1-[(1E)-2-chloro-1-[(5-methyl-1H-pyrazol-3-yl)amino]buta-1,3-dienyl]guanidine (PubChem CID 89160299) has the molecular formula C19H25ClFN7 and a molecular weight of 405.91 g/mol. Its IUPAC name is 2-[(1S,2Z,4E)-2-amino-1-cyclopropyl-5-fluorohepta-2,4,6-trienyl]-1-[(1E)-2-chloro-1-[(5-methyl-1H-pyrazol-3-yl)amino]buta-1,3-dienyl]guanidine.
| Compound Name | 2-[(1S,2Z,4E)-2-amino-1-cyclopropyl-5-fluorohepta-2,4,6-trienyl]-1-[(1E)-2-chloro-1-[(5-methyl-1H-pyrazol-3-yl)amino]buta-1,3-dienyl]guanidine |
|---|---|
| PubChem CID | 89160299 |
| Molecular Formula | C19H25ClFN7 |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-[(1S,2Z,4E)-2-amino-1-cyclopropyl-5-fluorohepta-2,4,6-trienyl]-1-[(1E)-2-chloro-1-[(5-methyl-1H-pyrazol-3-yl)amino]buta-1,3-dienyl]guanidine |
| SMILES | C=C/C(F)=C\C=C(/N)[C@@H](/N=C(\N)N/C(Nc1cc(C)[nH]n1)=C(/Cl)C=C)C1CC1 |
| InChI | InChI=1S/C19H25ClFN7/c1-4-13(21)8-9-15(22)17(12-6-7-12)25-19(23)26-18(14(20)5-2)24-16-10-11(3)27-28-16/h4-5,8-10,12,17H,1-2,6-7,22H2,3H3,(H3,23,25,26)(H2,24,27,28)/b13-8+,15-9-,18-14+/t17-/m0/s1 |
| InChIKey | SETJJINZAFWKHT-SFCAXAMWSA-N |
| XLogP | 3.29 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|