C6H8FN — CID 89160332
3-fluoro-4-methyl-1,2-dihydropyridine (PubChem CID 89160332) has the molecular formula C6H8FN and a molecular weight of 113.13 g/mol. Its IUPAC name is 3-fluoro-4-methyl-1,2-dihydropyridine.
| Compound Name | 3-fluoro-4-methyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 89160332 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 3-fluoro-4-methyl-1,2-dihydropyridine |
| SMILES | CC1=C(F)CNC=C1 |
| InChI | InChI=1S/C6H8FN/c1-5-2-3-8-4-6(5)7/h2-3,8H,4H2,1H3 |
| InChIKey | ILJYVGULHVRFQY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |