About 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one
2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one (PubChem CID 89160481) has the molecular formula C19H32O2
and a molecular weight of 292.46 g/mol. Its IUPAC name is 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one.
Molecular Properties
| Compound Name | 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one |
| PubChem CID | 89160481 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one |
| SMILES | C=CCC1CCCC(=O)C1C(O)[C@@H](CC)C/C=C/C(C)C |
| InChI | InChI=1S/C19H32O2/c1-5-9-16-12-8-13-17(20)18(16)19(21)15(6-2)11-7-10-14(3)4/h5,7,10,14-16,18-19,21H,1,6,8-9,11-13H2,2-4H3/b10-7+/t15-,16?,18?,19?/m0/s1 |
| InChIKey | HXSUVQRRTVIDHF-PESYSLOESA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one?
The IUPAC name of 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one (CID 89160481) is 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one.
What is the SMILES notation for 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one?
The canonical SMILES for 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one is C=CCC1CCCC(=O)C1C(O)[C@@H](CC)C/C=C/C(C)C.
What is the InChIKey of 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one?
The InChIKey is HXSUVQRRTVIDHF-PESYSLOESA-N. The full InChI is InChI=1S/C19H32O2/c1-5-9-16-12-8-13-17(20)18(16)19(21)15(6-2)11-7-10-14(3)4/h5,7,10,14-16,18-19,21H,1,6,8-9,11-13H2,2-4H3/b10-7+/t15-,16?,18?,19?/m0/s1.
What are the key properties of 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one?
2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one has a molecular weight of 292.46 g/mol, XLogP of 4.54, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E,2S)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one is sourced from PubChem (CID 89160481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).