C18H25F2N7 — CID 89160492
2-[(3S,4Z,6E)-4-amino-7-fluoronona-4,6,8-trien-3-yl]-1-[(1E)-2-fluoro-1-[(5-methyl-1H-pyrazol-3-yl)amino]buta-1,3-dienyl]guanidine (PubChem CID 89160492) has the molecular formula C18H25F2N7 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[(3S,4Z,6E)-4-amino-7-fluoronona-4,6,8-trien-3-yl]-1-[(1E)-2-fluoro-1-[(5-methyl-1H-pyrazol-3-yl)amino]buta-1,3-dienyl]guanidine.
| Compound Name | 2-[(3S,4Z,6E)-4-amino-7-fluoronona-4,6,8-trien-3-yl]-1-[(1E)-2-fluoro-1-[(5-methyl-1H-pyrazol-3-yl)amino]buta-1,3-dienyl]guanidine |
|---|---|
| PubChem CID | 89160492 |
| Molecular Formula | C18H25F2N7 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[(3S,4Z,6E)-4-amino-7-fluoronona-4,6,8-trien-3-yl]-1-[(1E)-2-fluoro-1-[(5-methyl-1H-pyrazol-3-yl)amino]buta-1,3-dienyl]guanidine |
| SMILES | C=C/C(F)=C\C=C(/N)[C@H](CC)/N=C(\N)N/C(Nc1cc(C)[nH]n1)=C(/F)C=C |
| InChI | InChI=1S/C18H25F2N7/c1-5-12(19)8-9-14(21)15(7-3)23-18(22)25-17(13(20)6-2)24-16-10-11(4)26-27-16/h5-6,8-10,15H,1-2,7,21H2,3-4H3,(H3,22,23,25)(H2,24,26,27)/b12-8+,14-9-,17-13+/t15-/m0/s1 |
| InChIKey | YQJAUYDGUKOCOJ-SYZLOPGNSA-N |
| XLogP | 3.02 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|