C29H34F2N6O — CID 89160524
7-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]-N-[(1E,3E)-6-methyl-1-[(2R)-pyrrolidin-2-yl]hepta-1,3,5-trien-4-yl]pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 89160524) has the molecular formula C29H34F2N6O and a molecular weight of 520.63 g/mol. Its IUPAC name is 7-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]-N-[(1E,3E)-6-methyl-1-[(2R)-pyrrolidin-2-yl]hepta-1,3,5-trien-4-yl]pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]-N-[(1E,3E)-6-methyl-1-[(2R)-pyrrolidin-2-yl]hepta-1,3,5-trien-4-yl]pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 89160524 |
| Molecular Formula | C29H34F2N6O |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 7-[3,5-difluoro-4-(morpholin-4-ylmethyl)phenyl]-N-[(1E,3E)-6-methyl-1-[(2R)-pyrrolidin-2-yl]hepta-1,3,5-trien-4-yl]pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CC(C)=C/C(=C\C=C\[C@H]1CCCN1)Nc1ncc2ccn(-c3cc(F)c(CN4CCOCC4)c(F)c3)c2n1 |
| InChI | InChI=1S/C29H34F2N6O/c1-20(2)15-23(6-3-5-22-7-4-9-32-22)34-29-33-18-21-8-10-37(28(21)35-29)24-16-26(30)25(27(31)17-24)19-36-11-13-38-14-12-36/h3,5-6,8,10,15-18,22,32H,4,7,9,11-14,19H2,1-2H3,(H,33,34,35)/b5-3+,23-6+/t22-/m0/s1 |
| InChIKey | CJOXYZJPLQFGAP-BHTSKGIASA-N |
| XLogP | 5.10 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|