C19H32O2 — CID 89160645
trans-(2R,3S)-2-[(E,1R)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one (PubChem CID 89160645) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is trans-(2R,3S)-2-[(E,1R)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one.
| Compound Name | trans-(2R,3S)-2-[(E,1R)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one |
|---|---|
| PubChem CID | 89160645 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | trans-(2R,3S)-2-[(E,1R)-2-ethyl-1-hydroxy-6-methylhept-4-enyl]-3-prop-2-enylcyclohexan-1-one |
| SMILES | C=CC[C@@H]1CCCC(=O)[C@H]1[C@H](O)C(CC)C/C=C/C(C)C |
| InChI | InChI=1S/C19H32O2/c1-5-9-16-12-8-13-17(20)18(16)19(21)15(6-2)11-7-10-14(3)4/h5,7,10,14-16,18-19,21H,1,6,8-9,11-13H2,2-4H3/b10-7+/t15?,16-,18+,19-/m1/s1 |
| InChIKey | HXSUVQRRTVIDHF-HKNFBIOBSA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|