C14H17IN4 — CID 89160652
5-amino-1-[(1E,3Z)-1-(2-iodo-4-methylcyclobutyl)penta-1,3-dien-2-yl]pyrazole-4-carbonitrile (PubChem CID 89160652) has the molecular formula C14H17IN4 and a molecular weight of 368.22 g/mol. Its IUPAC name is 5-amino-1-[(1E,3Z)-1-(2-iodo-4-methylcyclobutyl)penta-1,3-dien-2-yl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[(1E,3Z)-1-(2-iodo-4-methylcyclobutyl)penta-1,3-dien-2-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 89160652 |
| Molecular Formula | C14H17IN4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 5-amino-1-[(1E,3Z)-1-(2-iodo-4-methylcyclobutyl)penta-1,3-dien-2-yl]pyrazole-4-carbonitrile |
| SMILES | C/C=C\C(=C/C1C(C)CC1I)n1ncc(C#N)c1N |
| InChI | InChI=1S/C14H17IN4/c1-3-4-11(6-12-9(2)5-13(12)15)19-14(17)10(7-16)8-18-19/h3-4,6,8-9,12-13H,5,17H2,1-2H3/b4-3-,11-6+ |
| InChIKey | UZGBMLDQYDJESX-KXLXTGLCSA-N |
| XLogP | 3.21 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|