About 2-phenyl-1,5-dihydro-1,2,4-triazole
2-phenyl-1,5-dihydro-1,2,4-triazole (PubChem CID 89160676) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-phenyl-1,5-dihydro-1,2,4-triazole.
Molecular Properties
| Compound Name | 2-phenyl-1,5-dihydro-1,2,4-triazole |
| PubChem CID | 89160676 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 2-phenyl-1,5-dihydro-1,2,4-triazole |
| SMILES | C1=NCNN1c1ccccc1 |
| InChI | InChI=1S/C8H9N3/c1-2-4-8(5-3-1)11-7-9-6-10-11/h1-5,7,10H,6H2 |
| InChIKey | DVAVNAVTYVSEQX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-1,5-dihydro-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,5-dihydro-1,2,4-triazole?
The IUPAC name of 2-phenyl-1,5-dihydro-1,2,4-triazole (CID 89160676) is 2-phenyl-1,5-dihydro-1,2,4-triazole.
What is the SMILES notation for 2-phenyl-1,5-dihydro-1,2,4-triazole?
The canonical SMILES for 2-phenyl-1,5-dihydro-1,2,4-triazole is C1=NCNN1c1ccccc1.
What is the InChIKey of 2-phenyl-1,5-dihydro-1,2,4-triazole?
The InChIKey is DVAVNAVTYVSEQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-2-4-8(5-3-1)11-7-9-6-10-11/h1-5,7,10H,6H2.
What are the key properties of 2-phenyl-1,5-dihydro-1,2,4-triazole?
2-phenyl-1,5-dihydro-1,2,4-triazole has a molecular weight of 147.18 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,5-dihydro-1,2,4-triazole is sourced from PubChem (CID 89160676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).