C38H43F3N2O11 — CID 89161078
4-[[(2S,4R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-1-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetyl]pyrrolidin-2-yl]methoxy]-4-oxobutanoic acid (PubChem CID 89161078) has the molecular formula C38H43F3N2O11 and a molecular weight of 760.76 g/mol. Its IUPAC name is 4-[[(2S,4R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-1-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetyl]pyrrolidin-2-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S,4R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-1-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetyl]pyrrolidin-2-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89161078 |
| Molecular Formula | C38H43F3N2O11 |
| Molecular Weight | 760.76 g/mol |
| Exact Mass | 760.28 |
| IUPAC Name | 4-[[(2S,4R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-1-[2-[2-[2-[(2,2,2-trifluoroacetyl)amino]ethoxy]ethoxy]acetyl]pyrrolidin-2-yl]methoxy]-4-oxobutanoic acid |
| SMILES | COc1ccc(C(O[C@@H]2C[C@@H](COC(=O)CCC(=O)O)N(C(=O)COCCOCCNC(=O)C(F)(F)F)C2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H43F3N2O11/c1-49-30-12-8-27(9-13-30)37(26-6-4-3-5-7-26,28-10-14-31(50-2)15-11-28)54-32-22-29(24-53-35(47)17-16-34(45)46)43(23-32)33(44)25-52-21-20-51-19-18-42-36(48)38(39,40)41/h3-15,29,32H,16-25H2,1-2H3,(H,42,48)(H,45,46)/t29-,32+/m0/s1 |
| InChIKey | NZMKKFKCUYBBNW-BHDXBOSCSA-N |
| XLogP | 4.10 |
| TPSA | 159.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|