About 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one
3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one (PubChem CID 89161085) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one |
| PubChem CID | 89161085 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one |
| SMILES | CC1CCN(C(C)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C11H21NO2/c1-8-6-7-12(10(13)14-8)9(2)11(3,4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | WTHZQKOGBCGTHD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one?
The IUPAC name of 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one (CID 89161085) is 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one.
What is the SMILES notation for 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one?
The canonical SMILES for 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one is CC1CCN(C(C)C(C)(C)C)C(=O)O1.
What is the InChIKey of 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one?
The InChIKey is WTHZQKOGBCGTHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-8-6-7-12(10(13)14-8)9(2)11(3,4)5/h8-9H,6-7H2,1-5H3.
What are the key properties of 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one?
3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one has a molecular weight of 199.29 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylbutan-2-yl)-6-methyl-1,3-oxazinan-2-one is sourced from PubChem (CID 89161085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).