C8H7N5O — CID 89161257
3,5,7,9,12-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-10-one (PubChem CID 89161257) has the molecular formula C8H7N5O and a molecular weight of 189.18 g/mol. Its IUPAC name is 3,5,7,9,12-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-10-one.
| Compound Name | 3,5,7,9,12-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-10-one |
|---|---|
| PubChem CID | 89161257 |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 3,5,7,9,12-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-10-one |
| SMILES | O=C1CNc2c[nH]c3ncnc(c23)N1 |
| InChI | InChI=1S/C8H7N5O/c14-5-2-9-4-1-10-7-6(4)8(13-5)12-3-11-7/h1,3,9H,2H2,(H2,10,11,12,13,14) |
| InChIKey | VOWQILHICTVEKA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |