C22H23I — CID 89161558
2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-iodo-9,9-dimethyl-3,4-dihydrofluorene (PubChem CID 89161558) has the molecular formula C22H23I and a molecular weight of 414.33 g/mol. Its IUPAC name is 2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-iodo-9,9-dimethyl-3,4-dihydrofluorene.
| Compound Name | 2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-iodo-9,9-dimethyl-3,4-dihydrofluorene |
|---|---|
| PubChem CID | 89161558 |
| Molecular Formula | C22H23I |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-7-iodo-9,9-dimethyl-3,4-dihydrofluorene |
| SMILES | C=C(/C=C\C=C/C)C1=CC2=C(CC1)c1ccc(I)cc1C2(C)C |
| InChI | InChI=1S/C22H23I/c1-5-6-7-8-15(2)16-9-11-18-19-12-10-17(23)14-21(19)22(3,4)20(18)13-16/h5-8,10,12-14H,2,9,11H2,1,3-4H3/b6-5-,8-7- |
| InChIKey | GOSRUROKNQVEEQ-ISTTXYCBSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|