C25H25I — CID 89161599
2-(6-iodo-7,8-dihydronaphthalen-2-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene (PubChem CID 89161599) has the molecular formula C25H25I and a molecular weight of 452.38 g/mol. Its IUPAC name is 2-(6-iodo-7,8-dihydronaphthalen-2-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene.
| Compound Name | 2-(6-iodo-7,8-dihydronaphthalen-2-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene |
|---|---|
| PubChem CID | 89161599 |
| Molecular Formula | C25H25I |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-(6-iodo-7,8-dihydronaphthalen-2-yl)-9,9-dimethyl-1,5,6,9a-tetrahydrofluorene |
| SMILES | CC1(C)C2=C(CCC=C2)C2=CC=C(c3ccc4c(c3)CCC(I)=C4)CC21 |
| InChI | InChI=1S/C25H25I/c1-25(2)23-6-4-3-5-21(23)22-12-10-19(15-24(22)25)16-7-8-18-14-20(26)11-9-17(18)13-16/h4,6-8,10,12-14,24H,3,5,9,11,15H2,1-2H3 |
| InChIKey | LDQAQAPXHGFXDC-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|