About 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine
4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine (PubChem CID 89161956) has the molecular formula C13H22IN3
and a molecular weight of 347.24 g/mol. Its IUPAC name is 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine |
| PubChem CID | 89161956 |
| Molecular Formula | C13H22IN3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine |
| SMILES | CCNC1C=CC(CC2=NCCN2)C(C)C1I |
| InChI | InChI=1S/C13H22IN3/c1-3-15-11-5-4-10(9(2)13(11)14)8-12-16-6-7-17-12/h4-5,9-11,13,15H,3,6-8H2,1-2H3,(H,16,17) |
| InChIKey | AOGOUIZWBKSOKB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine?
The IUPAC name of 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine (CID 89161956) is 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine.
What is the SMILES notation for 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine?
The canonical SMILES for 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine is CCNC1C=CC(CC2=NCCN2)C(C)C1I.
What is the InChIKey of 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine?
The InChIKey is AOGOUIZWBKSOKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22IN3/c1-3-15-11-5-4-10(9(2)13(11)14)8-12-16-6-7-17-12/h4-5,9-11,13,15H,3,6-8H2,1-2H3,(H,16,17).
What are the key properties of 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine?
4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine has a molecular weight of 347.24 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-ethyl-6-iodo-5-methylcyclohex-2-en-1-amine is sourced from PubChem (CID 89161956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).