C19H29OP — CID 89162147
(3S,9S,14S)-10,13-dimethyl-17-phosphanylidene-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 89162147) has the molecular formula C19H29OP and a molecular weight of 304.41 g/mol. Its IUPAC name is (3S,9S,14S)-10,13-dimethyl-17-phosphanylidene-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,9S,14S)-10,13-dimethyl-17-phosphanylidene-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 89162147 |
| Molecular Formula | C19H29OP |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (3S,9S,14S)-10,13-dimethyl-17-phosphanylidene-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | [H]/P=C1\CC[C@H]2C3CC=C4C[C@@H](O)CCC4(C)[C@H]3CCC12C |
| InChI | InChI=1S/C19H29OP/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3,13-16,20-21H,4-11H2,1-2H3/t13-,14?,15-,16-,18?,19?/m0/s1 |
| InChIKey | RPCCLGWAQPVTTE-JCLGQITHSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|