About 3-aminonaphthalene-1,5-dithiol
3-aminonaphthalene-1,5-dithiol (PubChem CID 89162273) has the molecular formula C10H9NS2
and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-aminonaphthalene-1,5-dithiol.
Molecular Properties
| Compound Name | 3-aminonaphthalene-1,5-dithiol |
| PubChem CID | 89162273 |
| Molecular Formula | C10H9NS2 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 3-aminonaphthalene-1,5-dithiol |
| SMILES | Nc1cc(S)c2cccc(S)c2c1 |
| InChI | InChI=1S/C10H9NS2/c11-6-4-8-7(10(13)5-6)2-1-3-9(8)12/h1-5,12-13H,11H2 |
| InChIKey | IUFIDCKPYBWICT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-aminonaphthalene-1,5-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminonaphthalene-1,5-dithiol?
The IUPAC name of 3-aminonaphthalene-1,5-dithiol (CID 89162273) is 3-aminonaphthalene-1,5-dithiol.
What is the SMILES notation for 3-aminonaphthalene-1,5-dithiol?
The canonical SMILES for 3-aminonaphthalene-1,5-dithiol is Nc1cc(S)c2cccc(S)c2c1.
What is the InChIKey of 3-aminonaphthalene-1,5-dithiol?
The InChIKey is IUFIDCKPYBWICT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS2/c11-6-4-8-7(10(13)5-6)2-1-3-9(8)12/h1-5,12-13H,11H2.
What are the key properties of 3-aminonaphthalene-1,5-dithiol?
3-aminonaphthalene-1,5-dithiol has a molecular weight of 207.32 g/mol, XLogP of 3.00, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminonaphthalene-1,5-dithiol is sourced from PubChem (CID 89162273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).