About [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane
[(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane (PubChem CID 89162364) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane.
Molecular Properties
| Compound Name | [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane |
| PubChem CID | 89162364 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane |
| SMILES | C=C/C(=C\C)OCC1CCCC1 |
| InChI | InChI=1S/C11H18O/c1-3-11(4-2)12-9-10-7-5-6-8-10/h3-4,10H,1,5-9H2,2H3/b11-4+ |
| InChIKey | QMXMAXULNIEVDS-NYYWCZLTSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane?
The IUPAC name of [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane (CID 89162364) is [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane.
What is the SMILES notation for [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane?
The canonical SMILES for [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane is C=C/C(=C\C)OCC1CCCC1.
What is the InChIKey of [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane?
The InChIKey is QMXMAXULNIEVDS-NYYWCZLTSA-N. The full InChI is InChI=1S/C11H18O/c1-3-11(4-2)12-9-10-7-5-6-8-10/h3-4,10H,1,5-9H2,2H3/b11-4+.
What are the key properties of [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane?
[(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane has a molecular weight of 166.26 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-penta-1,3-dien-3-yl]oxymethylcyclopentane is sourced from PubChem (CID 89162364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).