About N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide
N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide (PubChem CID 89162521) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide.
Molecular Properties
| Compound Name | N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide |
| PubChem CID | 89162521 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide |
| SMILES | CC#CC(=O)N(C)CC1=CC=CC1 |
| InChI | InChI=1S/C11H13NO/c1-3-6-11(13)12(2)9-10-7-4-5-8-10/h4-5,7H,8-9H2,1-2H3 |
| InChIKey | AXLUFLBJFWVKPF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide?
The IUPAC name of N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide (CID 89162521) is N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide.
What is the SMILES notation for N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide?
The canonical SMILES for N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide is CC#CC(=O)N(C)CC1=CC=CC1.
What is the InChIKey of N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide?
The InChIKey is AXLUFLBJFWVKPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-3-6-11(13)12(2)9-10-7-4-5-8-10/h4-5,7H,8-9H2,1-2H3.
What are the key properties of N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide?
N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide has a molecular weight of 175.23 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopenta-1,3-dien-1-ylmethyl)-N-methylbut-2-ynamide is sourced from PubChem (CID 89162521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).