C7H9N3S — CID 89162544
4,7-dimethyl-3,3a-dihydro-[1,2,5]thiadiazolo[3,4-c]pyridine (PubChem CID 89162544) has the molecular formula C7H9N3S and a molecular weight of 167.24 g/mol. Its IUPAC name is 4,7-dimethyl-3,3a-dihydro-[1,2,5]thiadiazolo[3,4-c]pyridine.
| Compound Name | 4,7-dimethyl-3,3a-dihydro-[1,2,5]thiadiazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 89162544 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 4,7-dimethyl-3,3a-dihydro-[1,2,5]thiadiazolo[3,4-c]pyridine |
| SMILES | CC1=CN=C(C)C2NSN=C12 |
| InChI | InChI=1S/C7H9N3S/c1-4-3-8-5(2)7-6(4)9-11-10-7/h3,7,10H,1-2H3 |
| InChIKey | FOMHZNCRGTZCHU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|