About 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine
4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine (PubChem CID 89162763) has the molecular formula C11H16FN
and a molecular weight of 181.25 g/mol. Its IUPAC name is 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine.
Molecular Properties
| Compound Name | 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine |
| PubChem CID | 89162763 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine |
| SMILES | C=C/C=C(/F)C(=C)C1CCNCC1 |
| InChI | InChI=1S/C11H16FN/c1-3-4-11(12)9(2)10-5-7-13-8-6-10/h3-4,10,13H,1-2,5-8H2/b11-4+ |
| InChIKey | QFLPKIOFRXIOIB-NYYWCZLTSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine?
The IUPAC name of 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine (CID 89162763) is 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine.
What is the SMILES notation for 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine?
The canonical SMILES for 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine is C=C/C=C(/F)C(=C)C1CCNCC1.
What is the InChIKey of 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine?
The InChIKey is QFLPKIOFRXIOIB-NYYWCZLTSA-N. The full InChI is InChI=1S/C11H16FN/c1-3-4-11(12)9(2)10-5-7-13-8-6-10/h3-4,10,13H,1-2,5-8H2/b11-4+.
What are the key properties of 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine?
4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine has a molecular weight of 181.25 g/mol, XLogP of 2.58, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-3-fluorohexa-1,3,5-trien-2-yl]piperidine is sourced from PubChem (CID 89162763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).