C10H3BrF9IS — CID 89163195
3-bromo-4-[(E)-3,3,4,4,5,5,6,6,6-nonafluoro-1-iodohex-1-enyl]thiophene (PubChem CID 89163195) has the molecular formula C10H3BrF9IS and a molecular weight of 532.99 g/mol. Its IUPAC name is 3-bromo-4-[(E)-3,3,4,4,5,5,6,6,6-nonafluoro-1-iodohex-1-enyl]thiophene.
| Compound Name | 3-bromo-4-[(E)-3,3,4,4,5,5,6,6,6-nonafluoro-1-iodohex-1-enyl]thiophene |
|---|---|
| PubChem CID | 89163195 |
| Molecular Formula | C10H3BrF9IS |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 531.80 |
| IUPAC Name | 3-bromo-4-[(E)-3,3,4,4,5,5,6,6,6-nonafluoro-1-iodohex-1-enyl]thiophene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)/C=C(/I)c1cscc1Br |
| InChI | InChI=1S/C10H3BrF9IS/c11-5-3-22-2-4(5)6(21)1-7(12,13)8(14,15)9(16,17)10(18,19)20/h1-3H/b6-1+ |
| InChIKey | IUIICJFUVSSJSG-LZCJLJQNSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|