C8H2BrF9S — CID 89163196
3-bromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophene (PubChem CID 89163196) has the molecular formula C8H2BrF9S and a molecular weight of 381.06 g/mol. Its IUPAC name is 3-bromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophene.
| Compound Name | 3-bromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophene |
|---|---|
| PubChem CID | 89163196 |
| Molecular Formula | C8H2BrF9S |
| Molecular Weight | 381.06 g/mol |
| Exact Mass | 379.89 |
| IUPAC Name | 3-bromo-4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)thiophene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1cscc1Br |
| InChI | InChI=1S/C8H2BrF9S/c9-4-2-19-1-3(4)5(10,11)6(12,13)7(14,15)8(16,17)18/h1-2H |
| InChIKey | PSJOKKMPPCRFSQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.06 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|