About N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine
N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine (PubChem CID 89163269) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine |
| PubChem CID | 89163269 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine |
| SMILES | C=C1CC(NC(C)(C)C)CC(C)(C)N1 |
| InChI | InChI=1S/C12H24N2/c1-9-7-10(14-11(2,3)4)8-12(5,6)13-9/h10,13-14H,1,7-8H2,2-6H3 |
| InChIKey | IZCCSMKPOWSFPZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine?
The IUPAC name of N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine (CID 89163269) is N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine.
What is the SMILES notation for N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine?
The canonical SMILES for N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine is C=C1CC(NC(C)(C)C)CC(C)(C)N1.
What is the InChIKey of N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine?
The InChIKey is IZCCSMKPOWSFPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-9-7-10(14-11(2,3)4)8-12(5,6)13-9/h10,13-14H,1,7-8H2,2-6H3.
What are the key properties of N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine?
N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine has a molecular weight of 196.34 g/mol, XLogP of 2.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2-dimethyl-6-methylidenepiperidin-4-amine is sourced from PubChem (CID 89163269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).