About 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid
2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid (PubChem CID 89163460) has the molecular formula C22H15NO6
and a molecular weight of 389.36 g/mol. Its IUPAC name is 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid.
Molecular Properties
| Compound Name | 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid |
| PubChem CID | 89163460 |
| Molecular Formula | C22H15NO6 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid |
| SMILES | Nc1c(Oc2ccccc2)cc(OCC(=O)O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H15NO6/c23-20-16(29-12-6-2-1-3-7-12)10-15(28-11-17(24)25)18-19(20)22(27)14-9-5-4-8-13(14)21(18)26/h1-10H,11,23H2,(H,24,25) |
| InChIKey | IVFKGOKNPIGLIO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid?
The IUPAC name of 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid (CID 89163460) is 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid.
What is the SMILES notation for 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid?
The canonical SMILES for 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid is Nc1c(Oc2ccccc2)cc(OCC(=O)O)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid?
The InChIKey is IVFKGOKNPIGLIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO6/c23-20-16(29-12-6-2-1-3-7-12)10-15(28-11-17(24)25)18-19(20)22(27)14-9-5-4-8-13(14)21(18)26/h1-10H,11,23H2,(H,24,25).
What are the key properties of 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid?
2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid has a molecular weight of 389.36 g/mol, XLogP of 3.30, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-9,10-dioxo-3-phenoxyanthracen-1-yl)oxyacetic acid is sourced from PubChem (CID 89163460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).