C14H24O5 — CID 89163466
2-(3,3-dimethyloxiran-2-yl)-5-(1-hydroxy-2,2-dimethylpropyl)oxolane-3-carboxylic acid (PubChem CID 89163466) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-(3,3-dimethyloxiran-2-yl)-5-(1-hydroxy-2,2-dimethylpropyl)oxolane-3-carboxylic acid.
| Compound Name | 2-(3,3-dimethyloxiran-2-yl)-5-(1-hydroxy-2,2-dimethylpropyl)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 89163466 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-(3,3-dimethyloxiran-2-yl)-5-(1-hydroxy-2,2-dimethylpropyl)oxolane-3-carboxylic acid |
| SMILES | CC(C)(C)C(O)C1CC(C(=O)O)C(C2OC2(C)C)O1 |
| InChI | InChI=1S/C14H24O5/c1-13(2,3)10(15)8-6-7(12(16)17)9(18-8)11-14(4,5)19-11/h7-11,15H,6H2,1-5H3,(H,16,17) |
| InChIKey | VAHVSQVMFGZLCV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|