About (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate
(2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate (PubChem CID 89164080) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 89164080 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=C(C)C(=O)NCOC(=O)C1=CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H19NO3/c1-13(2)17(20)19-12-22-18(21)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-8,10H,1,9,11-12H2,2H3,(H,19,20) |
| InChIKey | HCZLZKOAKGIGSK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate (CID 89164080) is (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate is C=C(C)C(=O)NCOC(=O)C1=CC=C(c2ccccc2)CC1.
What is the InChIKey of (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate?
The InChIKey is HCZLZKOAKGIGSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-13(2)17(20)19-12-22-18(21)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-8,10H,1,9,11-12H2,2H3,(H,19,20).
What are the key properties of (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate?
(2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate has a molecular weight of 297.35 g/mol, XLogP of 2.98, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylprop-2-enoylamino)methyl 4-phenylcyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 89164080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).