C14H20F6O — CID 89164169
1,1,1,3,3,3-hexafluoro-2-[(2-pent-1-en-3-ylcyclopentyl)methyl]propan-2-ol (PubChem CID 89164169) has the molecular formula C14H20F6O and a molecular weight of 318.30 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[(2-pent-1-en-3-ylcyclopentyl)methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[(2-pent-1-en-3-ylcyclopentyl)methyl]propan-2-ol |
|---|---|
| PubChem CID | 89164169 |
| Molecular Formula | C14H20F6O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[(2-pent-1-en-3-ylcyclopentyl)methyl]propan-2-ol |
| SMILES | C=CC(CC)C1CCCC1CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H20F6O/c1-3-9(4-2)11-7-5-6-10(11)8-12(21,13(15,16)17)14(18,19)20/h3,9-11,21H,1,4-8H2,2H3 |
| InChIKey | QXHLOMMVOAVUKL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|