C28H28BNO6 — CID 89164293
CID 89164293 (PubChem CID 89164293) has the molecular formula C28H28BNO6 and a molecular weight of 485.35 g/mol.
| Compound Name | CID 89164293 |
|---|---|
| PubChem CID | 89164293 |
| Molecular Formula | C28H28BNO6 |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Oc2cc(CC(=O)OCC)ccc2OC)c(CN2C(=O)O[C@H](c3ccccc3)[C@@H]2C)c1 |
| InChI | InChI=1S/C28H28BNO6/c1-4-34-26(31)15-19-10-12-24(33-3)25(14-19)35-23-13-11-22(29)16-21(23)17-30-18(2)27(36-28(30)32)20-8-6-5-7-9-20/h5-14,16,18,27H,4,15,17H2,1-3H3/t18-,27-/m0/s1 |
| InChIKey | QFIFTYHOBUFXOF-MYUZEXMDSA-N |
| XLogP | 4.47 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|