C19H30N4O — CID 89164485
N-[(4E)-4-[(Z)-2-amino-3-(ethenylamino)prop-2-enylidene]-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-N-propylacetamide (PubChem CID 89164485) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is N-[(4E)-4-[(Z)-2-amino-3-(ethenylamino)prop-2-enylidene]-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-N-propylacetamide.
| Compound Name | N-[(4E)-4-[(Z)-2-amino-3-(ethenylamino)prop-2-enylidene]-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 89164485 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | N-[(4E)-4-[(Z)-2-amino-3-(ethenylamino)prop-2-enylidene]-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-N-propylacetamide |
| SMILES | C=CN/C=C(N)/C=C1\CCNC2CC=C(N(CCC)C(C)=O)CC12 |
| InChI | InChI=1S/C19H30N4O/c1-4-10-23(14(3)24)17-6-7-19-18(12-17)15(8-9-22-19)11-16(20)13-21-5-2/h5-6,11,13,18-19,21-22H,2,4,7-10,12,20H2,1,3H3/b15-11+,16-13- |
| InChIKey | UMKFWHVUAWJZMQ-KXWVESJESA-N |
| XLogP | 2.36 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |