About (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol
(3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol (PubChem CID 89164609) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol.
Molecular Properties
| Compound Name | (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol |
| PubChem CID | 89164609 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C(\N)c1ccccc1 |
| InChI | InChI=1S/C10H11NO/c1-8(12)7-10(11)9-5-3-2-4-6-9/h2-7,12H,1,11H2/b10-7- |
| InChIKey | YMIRZSSSMLXSBM-YFHOEESVSA-N |
| XLogP | 2.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol?
The IUPAC name of (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol (CID 89164609) is (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol.
What is the SMILES notation for (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol?
The canonical SMILES for (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol is C=C(O)/C=C(\N)c1ccccc1.
What is the InChIKey of (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol?
The InChIKey is YMIRZSSSMLXSBM-YFHOEESVSA-N. The full InChI is InChI=1S/C10H11NO/c1-8(12)7-10(11)9-5-3-2-4-6-9/h2-7,12H,1,11H2/b10-7-.
What are the key properties of (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol?
(3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol has a molecular weight of 161.20 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-amino-4-phenylbuta-1,3-dien-2-ol is sourced from PubChem (CID 89164609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).