C26H31F5O5 — CID 89164647
[6-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]naphthalen-2-yl] 4,4-dimethyl-2-propan-2-ylhexanoate (PubChem CID 89164647) has the molecular formula C26H31F5O5 and a molecular weight of 518.52 g/mol. Its IUPAC name is [6-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]naphthalen-2-yl] 4,4-dimethyl-2-propan-2-ylhexanoate.
| Compound Name | [6-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]naphthalen-2-yl] 4,4-dimethyl-2-propan-2-ylhexanoate |
|---|---|
| PubChem CID | 89164647 |
| Molecular Formula | C26H31F5O5 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | [6-[2-oxo-2-(2,2,3,3,3-pentafluoropropoxy)ethoxy]naphthalen-2-yl] 4,4-dimethyl-2-propan-2-ylhexanoate |
| SMILES | CCC(C)(C)CC(C(=O)Oc1ccc2cc(OCC(=O)OCC(F)(F)C(F)(F)F)ccc2c1)C(C)C |
| InChI | InChI=1S/C26H31F5O5/c1-6-24(4,5)13-21(16(2)3)23(33)36-20-10-8-17-11-19(9-7-18(17)12-20)34-14-22(32)35-15-25(27,28)26(29,30)31/h7-12,16,21H,6,13-15H2,1-5H3 |
| InChIKey | PXGXDCHKPOAMBD-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|