C12H11Cl3N2O — CID 89164895
(3aR,9bS)-2,6,7-trichloro-4-methyl-1,3,3a,9b-tetrahydropyrrolo[3,4-c]isoquinolin-5-one (PubChem CID 89164895) has the molecular formula C12H11Cl3N2O and a molecular weight of 305.59 g/mol. Its IUPAC name is (3aR,9bS)-2,6,7-trichloro-4-methyl-1,3,3a,9b-tetrahydropyrrolo[3,4-c]isoquinolin-5-one.
| Compound Name | (3aR,9bS)-2,6,7-trichloro-4-methyl-1,3,3a,9b-tetrahydropyrrolo[3,4-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 89164895 |
| Molecular Formula | C12H11Cl3N2O |
| Molecular Weight | 305.59 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | (3aR,9bS)-2,6,7-trichloro-4-methyl-1,3,3a,9b-tetrahydropyrrolo[3,4-c]isoquinolin-5-one |
| SMILES | CN1C(=O)c2c(ccc(Cl)c2Cl)[C@H]2CN(Cl)C[C@@H]21 |
| InChI | InChI=1S/C12H11Cl3N2O/c1-16-9-5-17(15)4-7(9)6-2-3-8(13)11(14)10(6)12(16)18/h2-3,7,9H,4-5H2,1H3/t7-,9+/m1/s1 |
| InChIKey | WXZFNHXACPJLSO-APPZFPTMSA-N |
| XLogP | 3.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|