C13H14Cl2N2O — CID 89164947
(3aS,9bR)-2,6-dichloro-8-ethyl-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one (PubChem CID 89164947) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is (3aS,9bR)-2,6-dichloro-8-ethyl-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one.
| Compound Name | (3aS,9bR)-2,6-dichloro-8-ethyl-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 89164947 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (3aS,9bR)-2,6-dichloro-8-ethyl-3,3a,4,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one |
| SMILES | CCc1cc(Cl)c2c(c1)[C@@H]1CN(Cl)C[C@H]1NC2=O |
| InChI | InChI=1S/C13H14Cl2N2O/c1-2-7-3-8-9-5-17(15)6-11(9)16-13(18)12(8)10(14)4-7/h3-4,9,11H,2,5-6H2,1H3,(H,16,18)/t9-,11+/m0/s1 |
| InChIKey | WYOPQTSHBLOVEA-GXSJLCMTSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|